C14H11Cl2NO3S — CID 19861966
(NE)-N-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]hydroxylamine (PubChem CID 19861966) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is (NE)-N-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 19861966 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | (NE)-N-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]hydroxylamine |
| SMILES | Cc1ccc(S(=O)(=O)/C(=N/O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c1-9-5-7-10(8-6-9)21(19,20)14(17-18)13-11(15)3-2-4-12(13)16/h2-8,18H,1H3/b17-14+ |
| InChIKey | AXVSVLIATGHHHK-SAPNQHFASA-N |
| XLogP | 3.91 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|