C14H11Cl2NOS — CID 88663870
(4-methylphenyl) (1E)-2,6-dichloro-N-hydroxybenzenecarboximidothioate (PubChem CID 88663870) has the molecular formula C14H11Cl2NOS and a molecular weight of 312.22 g/mol. Its IUPAC name is (4-methylphenyl) (1E)-2,6-dichloro-N-hydroxybenzenecarboximidothioate.
| Compound Name | (4-methylphenyl) (1E)-2,6-dichloro-N-hydroxybenzenecarboximidothioate |
|---|---|
| PubChem CID | 88663870 |
| Molecular Formula | C14H11Cl2NOS |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | (4-methylphenyl) (1E)-2,6-dichloro-N-hydroxybenzenecarboximidothioate |
| SMILES | Cc1ccc(S/C(=N/O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NOS/c1-9-5-7-10(8-6-9)19-14(17-18)13-11(15)3-2-4-12(13)16/h2-8,18H,1H3/b17-14+ |
| InChIKey | ZONPWXWIWUVCOF-SAPNQHFASA-N |
| XLogP | 5.23 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|