C11H11Cl2NO5S — CID 88653291
[[(2,6-dichlorophenyl)-methylsulfonylmethylidene]amino] ethyl carbonate (PubChem CID 88653291) has the molecular formula C11H11Cl2NO5S and a molecular weight of 340.18 g/mol. Its IUPAC name is [[(2,6-dichlorophenyl)-methylsulfonylmethylidene]amino] ethyl carbonate.
| Compound Name | [[(2,6-dichlorophenyl)-methylsulfonylmethylidene]amino] ethyl carbonate |
|---|---|
| PubChem CID | 88653291 |
| Molecular Formula | C11H11Cl2NO5S |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | [[(2,6-dichlorophenyl)-methylsulfonylmethylidene]amino] ethyl carbonate |
| SMILES | CCOC(=O)ON=C(c1c(Cl)cccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H11Cl2NO5S/c1-3-18-11(15)19-14-10(20(2,16)17)9-7(12)5-4-6-8(9)13/h4-6H,3H2,1-2H3 |
| InChIKey | MNCGEDPWEBJNKK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|