C10H10Cl2N2O4 — CID 137307483
[(Z)-[amino-(3,5-dichloro-2-hydroxyphenyl)methylidene]amino] ethyl carbonate (PubChem CID 137307483) has the molecular formula C10H10Cl2N2O4 and a molecular weight of 293.11 g/mol. Its IUPAC name is [(Z)-[amino-(3,5-dichloro-2-hydroxyphenyl)methylidene]amino] ethyl carbonate.
| Compound Name | [(Z)-[amino-(3,5-dichloro-2-hydroxyphenyl)methylidene]amino] ethyl carbonate |
|---|---|
| PubChem CID | 137307483 |
| Molecular Formula | C10H10Cl2N2O4 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | [(Z)-[amino-(3,5-dichloro-2-hydroxyphenyl)methylidene]amino] ethyl carbonate |
| SMILES | CCOC(=O)O/N=C(\N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H10Cl2N2O4/c1-2-17-10(16)18-14-9(13)6-3-5(11)4-7(12)8(6)15/h3-4,15H,2H2,1H3,(H2,13,14) |
| InChIKey | YGONOYKYMHLMIR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|