3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid

C7H13F3N2O5S — CID 103153466

IUPAC3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
SMILESCOC(CNS(=O)(=O)NCC(F)(F)F)CC(=O)O
InChIInChI=1S/C7H13F3N2O5S/c1-17-5(2-6(13)14)3-11-18(15,16)12-4-7(8,9)10/h5,11-12H,2-4H2,1H3,(H,13,14)
InChIKeyRSHCBCUARXLFPL-UHFFFAOYSA-N
MW294.25 g/mol
LogP-0.54
Rot. Bonds8

About 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid

3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (PubChem CID 103153466) has the molecular formula C7H13F3N2O5S and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.

Molecular Properties

Compound Name3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
PubChem CID103153466
Molecular FormulaC7H13F3N2O5S
Molecular Weight294.25 g/mol
Exact Mass294.05
IUPAC Name3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
SMILESCOC(CNS(=O)(=O)NCC(F)(F)F)CC(=O)O
InChIInChI=1S/C7H13F3N2O5S/c1-17-5(2-6(13)14)3-11-18(15,16)12-4-7(8,9)10/h5,11-12H,2-4H2,1H3,(H,13,14)
InChIKeyRSHCBCUARXLFPL-UHFFFAOYSA-N
XLogP-0.54
TPSA104.73 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.25
LogP ≤ 5-0.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The IUPAC name of 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (CID 103153466) is 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.
What is the SMILES notation for 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The canonical SMILES for 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid is COC(CNS(=O)(=O)NCC(F)(F)F)CC(=O)O.
What is the InChIKey of 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The InChIKey is RSHCBCUARXLFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O5S/c1-17-5(2-6(13)14)3-11-18(15,16)12-4-7(8,9)10/h5,11-12H,2-4H2,1H3,(H,13,14).
What are the key properties of 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid has a molecular weight of 294.25 g/mol, XLogP of -0.54, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid is sourced from PubChem (CID 103153466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).