C7H13F3N2O5S — CID 103153466
3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (PubChem CID 103153466) has the molecular formula C7H13F3N2O5S and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.
| Compound Name | 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
|---|---|
| PubChem CID | 103153466 |
| Molecular Formula | C7H13F3N2O5S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-methoxy-4-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
| SMILES | COC(CNS(=O)(=O)NCC(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C7H13F3N2O5S/c1-17-5(2-6(13)14)3-11-18(15,16)12-4-7(8,9)10/h5,11-12H,2-4H2,1H3,(H,13,14) |
| InChIKey | RSHCBCUARXLFPL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |