C10H19NO7S2 — CID 103153587
4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid (PubChem CID 103153587) has the molecular formula C10H19NO7S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid.
| Compound Name | 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153587 |
| Molecular Formula | C10H19NO7S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid |
| SMILES | COC(CNS(=O)(=O)C1CCS(=O)(=O)CC1)CC(=O)O |
| InChI | InChI=1S/C10H19NO7S2/c1-18-8(6-10(12)13)7-11-20(16,17)9-2-4-19(14,15)5-3-9/h8-9,11H,2-7H2,1H3,(H,12,13) |
| InChIKey | GDCGKWSCDSSVPW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |