4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid

C10H19NO7S2 — CID 103153587

IUPAC4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid
SMILESCOC(CNS(=O)(=O)C1CCS(=O)(=O)CC1)CC(=O)O
InChIInChI=1S/C10H19NO7S2/c1-18-8(6-10(12)13)7-11-20(16,17)9-2-4-19(14,15)5-3-9/h8-9,11H,2-7H2,1H3,(H,12,13)
InChIKeyGDCGKWSCDSSVPW-UHFFFAOYSA-N
MW329.40 g/mol
LogP-1.03
Rot. Bonds7

About 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid

4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid (PubChem CID 103153587) has the molecular formula C10H19NO7S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid
PubChem CID103153587
Molecular FormulaC10H19NO7S2
Molecular Weight329.40 g/mol
Exact Mass329.06
IUPAC Name4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid
SMILESCOC(CNS(=O)(=O)C1CCS(=O)(=O)CC1)CC(=O)O
InChIInChI=1S/C10H19NO7S2/c1-18-8(6-10(12)13)7-11-20(16,17)9-2-4-19(14,15)5-3-9/h8-9,11H,2-7H2,1H3,(H,12,13)
InChIKeyGDCGKWSCDSSVPW-UHFFFAOYSA-N
XLogP-1.03
TPSA126.84 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.40
LogP ≤ 5-1.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid?
The IUPAC name of 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid (CID 103153587) is 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid.
What is the SMILES notation for 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid?
The canonical SMILES for 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid is COC(CNS(=O)(=O)C1CCS(=O)(=O)CC1)CC(=O)O.
What is the InChIKey of 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid?
The InChIKey is GDCGKWSCDSSVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO7S2/c1-18-8(6-10(12)13)7-11-20(16,17)9-2-4-19(14,15)5-3-9/h8-9,11H,2-7H2,1H3,(H,12,13).
What are the key properties of 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid?
4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid has a molecular weight of 329.40 g/mol, XLogP of -1.03, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methoxybutanoic acid is sourced from PubChem (CID 103153587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).