C9H14F3NO4 — CID 103153021
3-methoxy-4-(4,4,4-trifluorobutanoylamino)butanoic acid (PubChem CID 103153021) has the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-methoxy-4-(4,4,4-trifluorobutanoylamino)butanoic acid.
| Compound Name | 3-methoxy-4-(4,4,4-trifluorobutanoylamino)butanoic acid |
|---|---|
| PubChem CID | 103153021 |
| Molecular Formula | C9H14F3NO4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-methoxy-4-(4,4,4-trifluorobutanoylamino)butanoic acid |
| SMILES | COC(CNC(=O)CCC(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C9H14F3NO4/c1-17-6(4-8(15)16)5-13-7(14)2-3-9(10,11)12/h6H,2-5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FGZHLWMPHVYVJR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |