C7H16N2O4S2 — CID 134306753
tert-butyl N-(2-sulfanylethylsulfamoyl)carbamate (PubChem CID 134306753) has the molecular formula C7H16N2O4S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl N-(2-sulfanylethylsulfamoyl)carbamate.
| Compound Name | tert-butyl N-(2-sulfanylethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 134306753 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | tert-butyl N-(2-sulfanylethylsulfamoyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCCS |
| InChI | InChI=1S/C7H16N2O4S2/c1-7(2,3)13-6(10)9-15(11,12)8-4-5-14/h8,14H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | HXWGQIQOJJZTAL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|