C9H18N2O6S — CID 15014351
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]propanoate (PubChem CID 15014351) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]propanoate |
|---|---|
| PubChem CID | 15014351 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O6S/c1-6(7(12)16-5)10-18(14,15)11-8(13)17-9(2,3)4/h6,10H,1-5H3,(H,11,13)/t6-/m0/s1 |
| InChIKey | GNCCTDKUYQRHGJ-LURJTMIESA-N |
| XLogP | -0.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |