C16H28F3NO4 — CID 156835510
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;trifluoromethylcyclohexane (PubChem CID 156835510) has the molecular formula C16H28F3NO4 and a molecular weight of 355.40 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;trifluoromethylcyclohexane.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;trifluoromethylcyclohexane |
|---|---|
| PubChem CID | 156835510 |
| Molecular Formula | C16H28F3NO4 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;trifluoromethylcyclohexane |
| SMILES | COC(=O)C(C)NC(=O)OC(C)(C)C.FC(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C9H17NO4.C7H11F3/c1-6(7(11)13-5)10-8(12)14-9(2,3)4;8-7(9,10)6-4-2-1-3-5-6/h6H,1-5H3,(H,10,12);6H,1-5H2 |
| InChIKey | XJWSLULBFITQCB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |