C20H36N2O3 — CID 175433446
tert-butyl N-(1-amino-3,3-dicyclohexyl-1-oxopropan-2-yl)carbamate (PubChem CID 175433446) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is tert-butyl N-(1-amino-3,3-dicyclohexyl-1-oxopropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-3,3-dicyclohexyl-1-oxopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 175433446 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | tert-butyl N-(1-amino-3,3-dicyclohexyl-1-oxopropan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(N)=O)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H36N2O3/c1-20(2,3)25-19(24)22-17(18(21)23)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h14-17H,4-13H2,1-3H3,(H2,21,23)(H,22,24) |
| InChIKey | AIEJTDLMUZNCFE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |