tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen

C8H22N2O4S — CID 176960460

IUPACtert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen
SMILESCC(C)NS(=O)(=O)NC(=O)OC(C)(C)C.[H][H].[H][H]
InChIInChI=1S/C8H18N2O4S.2H2/c1-6(2)9-15(12,13)10-7(11)14-8(3,4)5;;/h6,9H,1-5H3,(H,10,11);2*1H
InChIKeyCPQJXEUMFLPGQB-UHFFFAOYSA-N
MW242.34 g/mol
LogP1.25
Rot. Bonds3

About tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen

tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen (PubChem CID 176960460) has the molecular formula C8H22N2O4S and a molecular weight of 242.34 g/mol. Its IUPAC name is tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen.

Molecular Properties

Compound Nametert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen
PubChem CID176960460
Molecular FormulaC8H22N2O4S
Molecular Weight242.34 g/mol
Exact Mass242.13
IUPAC Nametert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen
SMILESCC(C)NS(=O)(=O)NC(=O)OC(C)(C)C.[H][H].[H][H]
InChIInChI=1S/C8H18N2O4S.2H2/c1-6(2)9-15(12,13)10-7(11)14-8(3,4)5;;/h6,9H,1-5H3,(H,10,11);2*1H
InChIKeyCPQJXEUMFLPGQB-UHFFFAOYSA-N
XLogP1.25
TPSA84.50 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.34
LogP ≤ 51.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen?
The IUPAC name of tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen (CID 176960460) is tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen.
What is the SMILES notation for tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen?
The canonical SMILES for tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen is CC(C)NS(=O)(=O)NC(=O)OC(C)(C)C.[H][H].[H][H].
What is the InChIKey of tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen?
The InChIKey is CPQJXEUMFLPGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O4S.2H2/c1-6(2)9-15(12,13)10-7(11)14-8(3,4)5;;/h6,9H,1-5H3,(H,10,11);2*1H.
What are the key properties of tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen?
tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen has a molecular weight of 242.34 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(propan-2-ylsulfamoyl)carbamate;molecular hydrogen is sourced from PubChem (CID 176960460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).