C17H29N3O4S — CID 110613438
tert-butyl N-[4-[3-(propan-2-ylsulfamoylamino)propyl]phenyl]carbamate (PubChem CID 110613438) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(propan-2-ylsulfamoylamino)propyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(propan-2-ylsulfamoylamino)propyl]phenyl]carbamate |
|---|---|
| PubChem CID | 110613438 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | tert-butyl N-[4-[3-(propan-2-ylsulfamoylamino)propyl]phenyl]carbamate |
| SMILES | CC(C)NS(=O)(=O)NCCCc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29N3O4S/c1-13(2)20-25(22,23)18-12-6-7-14-8-10-15(11-9-14)19-16(21)24-17(3,4)5/h8-11,13,18,20H,6-7,12H2,1-5H3,(H,19,21) |
| InChIKey | XBTWJOVOPLZPAS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|