C8H17ClN2O4S — CID 15473616
tert-butyl N-[2-chloroethyl(methyl)sulfamoyl]carbamate (PubChem CID 15473616) has the molecular formula C8H17ClN2O4S and a molecular weight of 272.75 g/mol. Its IUPAC name is tert-butyl N-[2-chloroethyl(methyl)sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[2-chloroethyl(methyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 15473616 |
| Molecular Formula | C8H17ClN2O4S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | tert-butyl N-[2-chloroethyl(methyl)sulfamoyl]carbamate |
| SMILES | CN(CCCl)S(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H17ClN2O4S/c1-8(2,3)15-7(12)10-16(13,14)11(4)6-5-9/h5-6H2,1-4H3,(H,10,12) |
| InChIKey | LWFKUZHOXANHLC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|