C8H18N2O5S — CID 106290429
methyl N-[(2-hydroxy-2-methylpentyl)sulfamoyl]carbamate (PubChem CID 106290429) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is methyl N-[(2-hydroxy-2-methylpentyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2-hydroxy-2-methylpentyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106290429 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl N-[(2-hydroxy-2-methylpentyl)sulfamoyl]carbamate |
| SMILES | CCCC(C)(O)CNS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C8H18N2O5S/c1-4-5-8(2,12)6-9-16(13,14)10-7(11)15-3/h9,12H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | QXQDMANFYCKVKC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |