C7H16N2O6S — CID 107866829
methyl N-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]sulfamoyl]carbamate (PubChem CID 107866829) has the molecular formula C7H16N2O6S and a molecular weight of 256.28 g/mol. Its IUPAC name is methyl N-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]sulfamoyl]carbamate.
| Compound Name | methyl N-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107866829 |
| Molecular Formula | C7H16N2O6S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | methyl N-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]sulfamoyl]carbamate |
| SMILES | CCC(CO)(CO)NS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C7H16N2O6S/c1-3-7(4-10,5-11)9-16(13,14)8-6(12)15-2/h9-11H,3-5H2,1-2H3,(H,8,12) |
| InChIKey | PJQUWVANVAPHFE-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |