C7H16N2O5S2 — CID 106306653
methyl N-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]carbamate (PubChem CID 106306653) has the molecular formula C7H16N2O5S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl N-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]carbamate.
| Compound Name | methyl N-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 106306653 |
| Molecular Formula | C7H16N2O5S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl N-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCCSCCCO |
| InChI | InChI=1S/C7H16N2O5S2/c1-14-7(11)9-16(12,13)8-3-6-15-5-2-4-10/h8,10H,2-6H2,1H3,(H,9,11) |
| InChIKey | GVBKMCUHHSGPFT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|