C7H18N2O6S — CID 107848380
2-(hydroxymethyl)-2-(2-methoxyethylsulfamoylamino)propane-1,3-diol (PubChem CID 107848380) has the molecular formula C7H18N2O6S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(2-methoxyethylsulfamoylamino)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(2-methoxyethylsulfamoylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 107848380 |
| Molecular Formula | C7H18N2O6S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(hydroxymethyl)-2-(2-methoxyethylsulfamoylamino)propane-1,3-diol |
| SMILES | COCCNS(=O)(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C7H18N2O6S/c1-15-3-2-8-16(13,14)9-7(4-10,5-11)6-12/h8-12H,2-6H2,1H3 |
| InChIKey | OUQSTTRHRHUUJJ-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|