C9H20N2O4S — CID 102739274
trans-(1R,2R)-2-(2-methoxyethylsulfamoylamino)cyclohexan-1-ol (PubChem CID 102739274) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-methoxyethylsulfamoylamino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-methoxyethylsulfamoylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102739274 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | trans-(1R,2R)-2-(2-methoxyethylsulfamoylamino)cyclohexan-1-ol |
| SMILES | COCCNS(=O)(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C9H20N2O4S/c1-15-7-6-10-16(13,14)11-8-4-2-3-5-9(8)12/h8-12H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | TWDRDQAPJDAFQC-RKDXNWHRSA-N |
| XLogP | -0.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|