About (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol
(1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 102739063) has the molecular formula C12H18N2O4S
and a molecular weight of 286.35 g/mol. Its IUPAC name is (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 102739063 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | COCCNS(=O)(=O)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C12H18N2O4S/c1-18-7-6-13-19(16,17)14-12-10-5-3-2-4-9(10)8-11(12)15/h2-5,11-15H,6-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | UJTUWUIPECAHHA-NWDGAFQWSA-N |
| XLogP | -0.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol (CID 102739063) is (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol is COCCNS(=O)(=O)N[C@@H]1c2ccccc2C[C@@H]1O.
What is the InChIKey of (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol?
The InChIKey is UJTUWUIPECAHHA-NWDGAFQWSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-18-7-6-13-19(16,17)14-12-10-5-3-2-4-9(10)8-11(12)15/h2-5,11-15H,6-8H2,1H3/t11-,12+/m0/s1.
What are the key properties of (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol?
(1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol has a molecular weight of 286.35 g/mol, XLogP of -0.28, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-(2-methoxyethylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 102739063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).