C12H18N2O3S — CID 115969830
1-(propan-2-ylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 115969830) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-(propan-2-ylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-(propan-2-ylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 115969830 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(propan-2-ylsulfamoylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | CC(C)NS(=O)(=O)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C12H18N2O3S/c1-8(2)13-18(16,17)14-12-10-6-4-3-5-9(10)7-11(12)15/h3-6,8,11-15H,7H2,1-2H3 |
| InChIKey | WVXCUJFBZJDLAJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |