C10H15N3O2S — CID 114812781
1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine (PubChem CID 114812781) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine.
| Compound Name | 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine |
|---|---|
| PubChem CID | 114812781 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine |
| SMILES | CNS(=O)(=O)NC1c2ccccc2CC1N |
| InChI | InChI=1S/C10H15N3O2S/c1-12-16(14,15)13-10-8-5-3-2-4-7(8)6-9(10)11/h2-5,9-10,12-13H,6,11H2,1H3 |
| InChIKey | NYTLJAYDLLOKSN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |