About 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine
1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine (PubChem CID 114812781) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine |
| PubChem CID | 114812781 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine |
| SMILES | CNS(=O)(=O)NC1c2ccccc2CC1N |
| InChI | InChI=1S/C10H15N3O2S/c1-12-16(14,15)13-10-8-5-3-2-4-7(8)6-9(10)11/h2-5,9-10,12-13H,6,11H2,1H3 |
| InChIKey | NYTLJAYDLLOKSN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine?
The IUPAC name of 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine (CID 114812781) is 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine.
What is the SMILES notation for 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine?
The canonical SMILES for 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine is CNS(=O)(=O)NC1c2ccccc2CC1N.
What is the InChIKey of 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine?
The InChIKey is NYTLJAYDLLOKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-12-16(14,15)13-10-8-5-3-2-4-7(8)6-9(10)11/h2-5,9-10,12-13H,6,11H2,1H3.
What are the key properties of 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine?
1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine has a molecular weight of 241.32 g/mol, XLogP of -0.34, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(methylsulfamoyl)-2,3-dihydro-1H-indene-1,2-diamine is sourced from PubChem (CID 114812781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).