C14H20N2O2S — CID 114985336
N-(2-amino-2,3-dihydro-1H-inden-1-yl)cyclopentanesulfonamide (PubChem CID 114985336) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(2-amino-2,3-dihydro-1H-inden-1-yl)cyclopentanesulfonamide.
| Compound Name | N-(2-amino-2,3-dihydro-1H-inden-1-yl)cyclopentanesulfonamide |
|---|---|
| PubChem CID | 114985336 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(2-amino-2,3-dihydro-1H-inden-1-yl)cyclopentanesulfonamide |
| SMILES | NC1Cc2ccccc2C1NS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C14H20N2O2S/c15-13-9-10-5-1-4-8-12(10)14(13)16-19(17,18)11-6-2-3-7-11/h1,4-5,8,11,13-14,16H,2-3,6-7,9,15H2 |
| InChIKey | PHLUIXLYGRXWIR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |