C13H21N3O2S — CID 63765446
2-amino-1-(diethylsulfamoylamino)-2,3-dihydro-1H-indene (PubChem CID 63765446) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-amino-1-(diethylsulfamoylamino)-2,3-dihydro-1H-indene.
| Compound Name | 2-amino-1-(diethylsulfamoylamino)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63765446 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-amino-1-(diethylsulfamoylamino)-2,3-dihydro-1H-indene |
| SMILES | CCN(CC)S(=O)(=O)NC1c2ccccc2CC1N |
| InChI | InChI=1S/C13H21N3O2S/c1-3-16(4-2)19(17,18)15-13-11-8-6-5-7-10(11)9-12(13)14/h5-8,12-13,15H,3-4,9,14H2,1-2H3 |
| InChIKey | BCRFWIAOUQACCR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |