C9H22N2O4S — CID 106143688
4-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-1-ol (PubChem CID 106143688) has the molecular formula C9H22N2O4S and a molecular weight of 254.35 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-1-ol.
| Compound Name | 4-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 106143688 |
| Molecular Formula | C9H22N2O4S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-1-ol |
| SMILES | COCCNS(=O)(=O)NCC(C)(C)CCO |
| InChI | InChI=1S/C9H22N2O4S/c1-9(2,4-6-12)8-11-16(13,14)10-5-7-15-3/h10-12H,4-8H2,1-3H3 |
| InChIKey | FEXQPPYQQRFABA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|