C5H15N3O5S2 — CID 114816615
2-(2-methoxyethylsulfamoylamino)ethanesulfonamide (PubChem CID 114816615) has the molecular formula C5H15N3O5S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfamoylamino)ethanesulfonamide.
| Compound Name | 2-(2-methoxyethylsulfamoylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114816615 |
| Molecular Formula | C5H15N3O5S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-(2-methoxyethylsulfamoylamino)ethanesulfonamide |
| SMILES | COCCNS(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C5H15N3O5S2/c1-13-4-2-7-15(11,12)8-3-5-14(6,9)10/h7-8H,2-5H2,1H3,(H2,6,9,10) |
| InChIKey | DWCLCYZFSFUSOU-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|