C8H18N2O5S — CID 114814766
4-(2-methoxyethylsulfamoylamino)-3-methylbutanoic acid (PubChem CID 114814766) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoylamino)-3-methylbutanoic acid.
| Compound Name | 4-(2-methoxyethylsulfamoylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114814766 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-(2-methoxyethylsulfamoylamino)-3-methylbutanoic acid |
| SMILES | COCCNS(=O)(=O)NCC(C)CC(=O)O |
| InChI | InChI=1S/C8H18N2O5S/c1-7(5-8(11)12)6-10-16(13,14)9-3-4-15-2/h7,9-10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | KNHBCEVOUUEAQL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|