C9H20N2O5S — CID 114814835
3-(2-methoxyethylsulfamoylamino)hexanoic acid (PubChem CID 114814835) has the molecular formula C9H20N2O5S and a molecular weight of 268.33 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoylamino)hexanoic acid.
| Compound Name | 3-(2-methoxyethylsulfamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114814835 |
| Molecular Formula | C9H20N2O5S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(2-methoxyethylsulfamoylamino)hexanoic acid |
| SMILES | CCCC(CC(=O)O)NS(=O)(=O)NCCOC |
| InChI | InChI=1S/C9H20N2O5S/c1-3-4-8(7-9(12)13)11-17(14,15)10-5-6-16-2/h8,10-11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | NUMLOIRNUJHXRM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|