C6H10F3NO4S — CID 81066675
3-methyl-4-(trifluoromethylsulfonylamino)butanoic acid (PubChem CID 81066675) has the molecular formula C6H10F3NO4S and a molecular weight of 249.21 g/mol. Its IUPAC name is 3-methyl-4-(trifluoromethylsulfonylamino)butanoic acid.
| Compound Name | 3-methyl-4-(trifluoromethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 81066675 |
| Molecular Formula | C6H10F3NO4S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 3-methyl-4-(trifluoromethylsulfonylamino)butanoic acid |
| SMILES | CC(CNS(=O)(=O)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C6H10F3NO4S/c1-4(2-5(11)12)3-10-15(13,14)6(7,8)9/h4,10H,2-3H2,1H3,(H,11,12) |
| InChIKey | LLQJNTGPQKDDRE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |