C17H27BrN2O5S — CID 59309479
tert-butyl N-[(2-bromo-4-tert-butyl-5-methoxyphenyl)methylsulfamoyl]carbamate (PubChem CID 59309479) has the molecular formula C17H27BrN2O5S and a molecular weight of 451.38 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-4-tert-butyl-5-methoxyphenyl)methylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[(2-bromo-4-tert-butyl-5-methoxyphenyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 59309479 |
| Molecular Formula | C17H27BrN2O5S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | tert-butyl N-[(2-bromo-4-tert-butyl-5-methoxyphenyl)methylsulfamoyl]carbamate |
| SMILES | COc1cc(CNS(=O)(=O)NC(=O)OC(C)(C)C)c(Br)cc1C(C)(C)C |
| InChI | InChI=1S/C17H27BrN2O5S/c1-16(2,3)12-9-13(18)11(8-14(12)24-7)10-19-26(22,23)20-15(21)25-17(4,5)6/h8-9,19H,10H2,1-7H3,(H,20,21) |
| InChIKey | SDSJGTNOLOHQQQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |