C17H25BrN2O8S — CID 172845724
3-(5-bromo-2-methoxy-4-nitrophenyl)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid (PubChem CID 172845724) has the molecular formula C17H25BrN2O8S and a molecular weight of 497.36 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxy-4-nitrophenyl)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid.
| Compound Name | 3-(5-bromo-2-methoxy-4-nitrophenyl)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 172845724 |
| Molecular Formula | C17H25BrN2O8S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 3-(5-bromo-2-methoxy-4-nitrophenyl)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
| SMILES | COc1cc([N+](=O)[O-])c(Br)cc1C(C)(CCS(=O)(=O)O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25BrN2O8S/c1-16(2,3)28-15(21)19-10-17(4,6-7-29(24,25)26)11-8-12(18)13(20(22)23)9-14(11)27-5/h8-9H,6-7,10H2,1-5H3,(H,19,21)(H,24,25,26) |
| InChIKey | XJUBTILRWLGHAX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|