C11H16FN3O4S — CID 114461411
ethyl N-[[4-(aminomethyl)-2-fluorophenyl]methylsulfamoyl]carbamate (PubChem CID 114461411) has the molecular formula C11H16FN3O4S and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl N-[[4-(aminomethyl)-2-fluorophenyl]methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[4-(aminomethyl)-2-fluorophenyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461411 |
| Molecular Formula | C11H16FN3O4S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl N-[[4-(aminomethyl)-2-fluorophenyl]methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCc1ccc(CN)cc1F |
| InChI | InChI=1S/C11H16FN3O4S/c1-2-19-11(16)15-20(17,18)14-7-9-4-3-8(6-13)5-10(9)12/h3-5,14H,2,6-7,13H2,1H3,(H,15,16) |
| InChIKey | OZHLARVRBMFUFP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |