C10H15FN2O4S2 — CID 82840107
N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82840107) has the molecular formula C10H15FN2O4S2 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82840107 |
| Molecular Formula | C10H15FN2O4S2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NCc1ccc(CN)cc1F |
| InChI | InChI=1S/C10H15FN2O4S2/c1-18(14,15)7-19(16,17)13-6-9-3-2-8(5-12)4-10(9)11/h2-4,13H,5-7,12H2,1H3 |
| InChIKey | CJSWNCANQUKMQF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |