C11H16FNO2S2 — CID 63659581
[3-fluoro-4-(2-methylsulfonylethylsulfanylmethyl)phenyl]methanamine (PubChem CID 63659581) has the molecular formula C11H16FNO2S2 and a molecular weight of 277.39 g/mol. Its IUPAC name is [3-fluoro-4-(2-methylsulfonylethylsulfanylmethyl)phenyl]methanamine.
| Compound Name | [3-fluoro-4-(2-methylsulfonylethylsulfanylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 63659581 |
| Molecular Formula | C11H16FNO2S2 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | [3-fluoro-4-(2-methylsulfonylethylsulfanylmethyl)phenyl]methanamine |
| SMILES | CS(=O)(=O)CCSCc1ccc(CN)cc1F |
| InChI | InChI=1S/C11H16FNO2S2/c1-17(14,15)5-4-16-8-10-3-2-9(7-13)6-11(10)12/h2-3,6H,4-5,7-8,13H2,1H3 |
| InChIKey | USYNITDLTCQEFP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|