C11H13FN2O4S2 — CID 62317190
methyl 2-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]propanoate (PubChem CID 62317190) has the molecular formula C11H13FN2O4S2 and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl 2-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]propanoate.
| Compound Name | methyl 2-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 62317190 |
| Molecular Formula | C11H13FN2O4S2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 2-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)Nc1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C11H13FN2O4S2/c1-6(11(15)18-2)20(16,17)14-7-3-4-9(12)8(5-7)10(13)19/h3-6,14H,1-2H3,(H2,13,19) |
| InChIKey | PGRIDFBWZMAUAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|