C15H12N2O5S3 — CID 167917056
N-[3-(benzenesulfonyl)phenyl]-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 167917056) has the molecular formula C15H12N2O5S3 and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)phenyl]-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)phenyl]-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 167917056 |
| Molecular Formula | C15H12N2O5S3 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | N-[3-(benzenesulfonyl)phenyl]-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)Nc2cccc(S(=O)(=O)c3ccccc3)c2)s1 |
| InChI | InChI=1S/C15H12N2O5S3/c18-15-16-10-14(23-15)25(21,22)17-11-5-4-8-13(9-11)24(19,20)12-6-2-1-3-7-12/h1-10,17H,(H,16,18) |
| InChIKey | GHEUAPJWSGHHEN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |