C19H15NO4S2 — CID 53124429
N-(3-acetylphenyl)-5-(benzenesulfonyl)thiophene-2-carboxamide (PubChem CID 53124429) has the molecular formula C19H15NO4S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5-(benzenesulfonyl)thiophene-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5-(benzenesulfonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53124429 |
| Molecular Formula | C19H15NO4S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-(3-acetylphenyl)-5-(benzenesulfonyl)thiophene-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H15NO4S2/c1-13(21)14-6-5-7-15(12-14)20-19(22)17-10-11-18(25-17)26(23,24)16-8-3-2-4-9-16/h2-12H,1H3,(H,20,22) |
| InChIKey | BXAIAFLRZDXXHZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |