C15H18N2O3S2 — CID 119626257
N-(2-amino-2-methylpropyl)-5-(benzenesulfonyl)thiophene-2-carboxamide (PubChem CID 119626257) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-5-(benzenesulfonyl)thiophene-2-carboxamide.
| Compound Name | N-(2-amino-2-methylpropyl)-5-(benzenesulfonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119626257 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-5-(benzenesulfonyl)thiophene-2-carboxamide |
| SMILES | CC(C)(N)CNC(=O)c1ccc(S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-15(2,16)10-17-14(18)12-8-9-13(21-12)22(19,20)11-6-4-3-5-7-11/h3-9H,10,16H2,1-2H3,(H,17,18) |
| InChIKey | GLMMXAWPGUDTNW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |