C19H25ClN2O3S2 — CID 119589307
N-(2-amino-1-cyclohexylethyl)-5-(benzenesulfonyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119589307) has the molecular formula C19H25ClN2O3S2 and a molecular weight of 429.01 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-(benzenesulfonyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-(benzenesulfonyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119589307 |
| Molecular Formula | C19H25ClN2O3S2 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-(benzenesulfonyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1ccc(S(=O)(=O)c2ccccc2)s1)C1CCCCC1 |
| InChI | InChI=1S/C19H24N2O3S2.ClH/c20-13-16(14-7-3-1-4-8-14)21-19(22)17-11-12-18(25-17)26(23,24)15-9-5-2-6-10-15;/h2,5-6,9-12,14,16H,1,3-4,7-8,13,20H2,(H,21,22);1H |
| InChIKey | SQNOATKDLFDTAZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |