C10H14Cl2N2OS — CID 119617339
N-(2-amino-1-cyclopropylethyl)-5-chlorothiophene-2-carboxamide;hydrochloride (PubChem CID 119617339) has the molecular formula C10H14Cl2N2OS and a molecular weight of 281.21 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-chlorothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-chlorothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119617339 |
| Molecular Formula | C10H14Cl2N2OS |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-chlorothiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1ccc(Cl)s1)C1CC1 |
| InChI | InChI=1S/C10H13ClN2OS.ClH/c11-9-4-3-8(15-9)10(14)13-7(5-12)6-1-2-6;/h3-4,6-7H,1-2,5,12H2,(H,13,14);1H |
| InChIKey | TWWGGZHLZNLYHB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |