C16H24ClNOS — CID 161296581
5-chloro-N-(1-cyclohexyl-3-methylbutyl)thiophene-2-carboxamide (PubChem CID 161296581) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 5-chloro-N-(1-cyclohexyl-3-methylbutyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(1-cyclohexyl-3-methylbutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 161296581 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-chloro-N-(1-cyclohexyl-3-methylbutyl)thiophene-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)s1)C1CCCCC1 |
| InChI | InChI=1S/C16H24ClNOS/c1-11(2)10-13(12-6-4-3-5-7-12)18-16(19)14-8-9-15(17)20-14/h8-9,11-13H,3-7,10H2,1-2H3,(H,18,19) |
| InChIKey | VHBBMJONKRKTSM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |