C16H26ClN3O3S — CID 119589468
N-(2-amino-1-cyclohexylethyl)-4-(methylsulfamoyl)benzamide;hydrochloride (PubChem CID 119589468) has the molecular formula C16H26ClN3O3S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-(methylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-(methylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119589468 |
| Molecular Formula | C16H26ClN3O3S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-(methylsulfamoyl)benzamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC(CN)C2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C16H25N3O3S.ClH/c1-18-23(21,22)14-9-7-13(8-10-14)16(20)19-15(11-17)12-5-3-2-4-6-12;/h7-10,12,15,18H,2-6,11,17H2,1H3,(H,19,20);1H |
| InChIKey | FMXWCHOGZKAVLE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |