C15H21N3O3S — CID 119617561
N-(2-amino-1-cyclopropylethyl)-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 119617561) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119617561 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NC(CN)C2CC2)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-2-9-17-22(20,21)13-7-5-12(6-8-13)15(19)18-14(10-16)11-3-4-11/h2,5-8,11,14,17H,1,3-4,9-10,16H2,(H,18,19) |
| InChIKey | VZLFMOXSFGHZAJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|