C11H13N3O5S — CID 175278982
[(4-sulfamoylphenyl)carbamoylamino] 2-methylprop-2-enoate (PubChem CID 175278982) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is [(4-sulfamoylphenyl)carbamoylamino] 2-methylprop-2-enoate.
| Compound Name | [(4-sulfamoylphenyl)carbamoylamino] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175278982 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [(4-sulfamoylphenyl)carbamoylamino] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ONC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H13N3O5S/c1-7(2)10(15)19-14-11(16)13-8-3-5-9(6-4-8)20(12,17)18/h3-6H,1H2,2H3,(H2,12,17,18)(H2,13,14,16) |
| InChIKey | YIQMOUCUTALBOL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|