C11H16N6O3S — CID 66664417
1-[1-[[amino(methyl)amino]methylideneamino]ethenyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 66664417) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[1-[[amino(methyl)amino]methylideneamino]ethenyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[1-[[amino(methyl)amino]methylideneamino]ethenyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 66664417 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[1-[[amino(methyl)amino]methylideneamino]ethenyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | C=C(N=CN(C)N)NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N6O3S/c1-8(14-7-17(2)12)15-11(18)16-9-3-5-10(6-4-9)21(13,19)20/h3-7H,1,12H2,2H3,(H2,13,19,20)(H2,15,16,18) |
| InChIKey | DCMJXOOELCOCFN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|