C15H14N4O3S — CID 123439376
1-(2-cyanophenyl)-1-methyl-3-(4-sulfamoylphenyl)urea (PubChem CID 123439376) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-1-methyl-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2-cyanophenyl)-1-methyl-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 123439376 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(2-cyanophenyl)-1-methyl-3-(4-sulfamoylphenyl)urea |
| SMILES | CN(C(=O)Nc1ccc(S(N)(=O)=O)cc1)c1ccccc1C#N |
| InChI | InChI=1S/C15H14N4O3S/c1-19(14-5-3-2-4-11(14)10-16)15(20)18-12-6-8-13(9-7-12)23(17,21)22/h2-9H,1H3,(H,18,20)(H2,17,21,22) |
| InChIKey | HMESIPRIZCSPHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |