C14H17N3O3S2 — CID 40881689
1-methyl-3-(4-sulfamoylphenyl)-1-[(1S)-1-thiophen-2-ylethyl]urea (PubChem CID 40881689) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-methyl-3-(4-sulfamoylphenyl)-1-[(1S)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-methyl-3-(4-sulfamoylphenyl)-1-[(1S)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 40881689 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-methyl-3-(4-sulfamoylphenyl)-1-[(1S)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@@H](c1cccs1)N(C)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-10(13-4-3-9-21-13)17(2)14(18)16-11-5-7-12(8-6-11)22(15,19)20/h3-10H,1-2H3,(H,16,18)(H2,15,19,20)/t10-/m0/s1 |
| InChIKey | OYILJHUMXJEJJO-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |