C15H16N2O3S — CID 42930016
3-(1,3-benzodioxol-5-yl)-1-methyl-1-(1-thiophen-2-ylethyl)urea (PubChem CID 42930016) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-methyl-1-(1-thiophen-2-ylethyl)urea.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-methyl-1-(1-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 42930016 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-methyl-1-(1-thiophen-2-ylethyl)urea |
| SMILES | CC(c1cccs1)N(C)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N2O3S/c1-10(14-4-3-7-21-14)17(2)15(18)16-11-5-6-12-13(8-11)20-9-19-12/h3-8,10H,9H2,1-2H3,(H,16,18) |
| InChIKey | QIOHGXMDGXOPHU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |