C13H19N3O5S — CID 5207855
4-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid (PubChem CID 5207855) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 5207855 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)Nc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H19N3O5S/c1-8(2)7-11(12(17)18)16-13(19)15-9-3-5-10(6-4-9)22(14,20)21/h3-6,8,11H,7H2,1-2H3,(H,17,18)(H2,14,20,21)(H2,15,16,19) |
| InChIKey | NABRDGJZLSPETF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |