C13H19N3O5S — CID 4680673
methyl 3-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]butanoate (PubChem CID 4680673) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 3-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]butanoate.
| Compound Name | methyl 3-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 4680673 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl 3-methyl-2-[(4-sulfamoylphenyl)carbamoylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)Nc1ccc(S(N)(=O)=O)cc1)C(C)C |
| InChI | InChI=1S/C13H19N3O5S/c1-8(2)11(12(17)21-3)16-13(18)15-9-4-6-10(7-5-9)22(14,19)20/h4-8,11H,1-3H3,(H2,14,19,20)(H2,15,16,18) |
| InChIKey | LGROMCZHDHBCFD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |